C26H32ClNO4 — CID 70701245
ethyl 1-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidine-4-carboxylate (PubChem CID 70701245) has the molecular formula C26H32ClNO4 and a molecular weight of 458.00 g/mol. Its IUPAC name is ethyl 1-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 70701245 |
| Molecular Formula | C26H32ClNO4 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 1-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidine-4-carboxylate |
| SMILES | C=CCOc1ccc(CN2CCC(CCOc3ccccc3)(C(=O)OCC)CC2)cc1Cl |
| InChI | InChI=1S/C26H32ClNO4/c1-3-17-32-24-11-10-21(19-23(24)27)20-28-15-12-26(13-16-28,25(29)30-4-2)14-18-31-22-8-6-5-7-9-22/h3,5-11,19H,1,4,12-18,20H2,2H3 |
| InChIKey | GBMWGWSGHNQSFC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|