C25H33NO5 — CID 45197896
ethyl 1-[[3-(2-hydroxyethoxy)phenyl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate (PubChem CID 45197896) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is ethyl 1-[[3-(2-hydroxyethoxy)phenyl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[3-(2-hydroxyethoxy)phenyl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45197896 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | ethyl 1-[[3-(2-hydroxyethoxy)phenyl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(CCOc2ccccc2)CCCN(Cc2cccc(OCCO)c2)C1 |
| InChI | InChI=1S/C25H33NO5/c1-2-29-24(28)25(13-16-30-22-9-4-3-5-10-22)12-7-14-26(20-25)19-21-8-6-11-23(18-21)31-17-15-27/h3-6,8-11,18,27H,2,7,12-17,19-20H2,1H3 |
| InChIKey | NBGRHOQHVSXXFF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |