C23H31NO5 — CID 45183806
ethyl 1-[[5-(methoxymethyl)furan-2-yl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate (PubChem CID 45183806) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is ethyl 1-[[5-(methoxymethyl)furan-2-yl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[5-(methoxymethyl)furan-2-yl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45183806 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | ethyl 1-[[5-(methoxymethyl)furan-2-yl]methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(CCOc2ccccc2)CCCN(Cc2ccc(COC)o2)C1 |
| InChI | InChI=1S/C23H31NO5/c1-3-27-22(25)23(13-15-28-19-8-5-4-6-9-19)12-7-14-24(18-23)16-20-10-11-21(29-20)17-26-2/h4-6,8-11H,3,7,12-18H2,1-2H3 |
| InChIKey | MUHPIYCLCRTNJM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |