C17H27NO4 — CID 72934146
3-(2-methoxyethyl)-1-[(5-propylfuran-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 72934146) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1-[(5-propylfuran-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 3-(2-methoxyethyl)-1-[(5-propylfuran-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72934146 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-(2-methoxyethyl)-1-[(5-propylfuran-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | CCCc1ccc(CN2CCCC(CCOC)(C(=O)O)C2)o1 |
| InChI | InChI=1S/C17H27NO4/c1-3-5-14-6-7-15(22-14)12-18-10-4-8-17(13-18,16(19)20)9-11-21-2/h6-7H,3-5,8-13H2,1-2H3,(H,19,20) |
| InChIKey | VTTIZIKJJGJNEB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |