C15H24N2O4 — CID 97132553
(3S)-3-(3-methoxypropyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 97132553) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3S)-3-(3-methoxypropyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-3-(3-methoxypropyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97132553 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (3S)-3-(3-methoxypropyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | COCCC[C@@]1(C(=O)O)CCCN(Cc2cc(C)no2)C1 |
| InChI | InChI=1S/C15H24N2O4/c1-12-9-13(21-16-12)10-17-7-3-5-15(11-17,14(18)19)6-4-8-20-2/h9H,3-8,10-11H2,1-2H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | HMIVVWNUUKCHID-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|