C16H24N2O3 — CID 97119130
(3R)-3-(3-methylbut-2-enyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 97119130) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3R)-3-(3-methylbut-2-enyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-(3-methylbut-2-enyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97119130 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3R)-3-(3-methylbut-2-enyl)-1-[(3-methyl-1,2-oxazol-5-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)=CC[C@]1(C(=O)O)CCCN(Cc2cc(C)no2)C1 |
| InChI | InChI=1S/C16H24N2O3/c1-12(2)5-7-16(15(19)20)6-4-8-18(11-16)10-14-9-13(3)17-21-14/h5,9H,4,6-8,10-11H2,1-3H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | MYSVASAHBUINFV-MRXNPFEDSA-N |
| XLogP | 3.01 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|