C16H23N3O3 — CID 86283128
3-(3-methylbut-2-enyl)-1-(5-methyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxylic acid (PubChem CID 86283128) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-(3-methylbut-2-enyl)-1-(5-methyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 3-(3-methylbut-2-enyl)-1-(5-methyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 86283128 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-(3-methylbut-2-enyl)-1-(5-methyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxylic acid |
| SMILES | CC(C)=CCC1(C(=O)O)CCCN(C(=O)c2cc(C)[nH]n2)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-11(2)5-7-16(15(21)22)6-4-8-19(10-16)14(20)13-9-12(3)17-18-13/h5,9H,4,6-8,10H2,1-3H3,(H,17,18)(H,21,22) |
| InChIKey | NCEUMNIPGVVIBT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|