C15H22N4O3 — CID 97122700
(3R)-3-(3-methylbut-2-enyl)-1-[2-(triazol-2-yl)acetyl]piperidine-3-carboxylic acid (PubChem CID 97122700) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (3R)-3-(3-methylbut-2-enyl)-1-[2-(triazol-2-yl)acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-(3-methylbut-2-enyl)-1-[2-(triazol-2-yl)acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97122700 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (3R)-3-(3-methylbut-2-enyl)-1-[2-(triazol-2-yl)acetyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)=CC[C@]1(C(=O)O)CCCN(C(=O)Cn2nccn2)C1 |
| InChI | InChI=1S/C15H22N4O3/c1-12(2)4-6-15(14(21)22)5-3-9-18(11-15)13(20)10-19-16-7-8-17-19/h4,7-8H,3,5-6,9-11H2,1-2H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | ZYCADTDYNIMORN-OAHLLOKOSA-N |
| XLogP | 1.33 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|