C20H29N3O3 — CID 97154272
(3R)-3-(3-methylbut-2-enyl)-1-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]piperidine-3-carboxylic acid (PubChem CID 97154272) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3R)-3-(3-methylbut-2-enyl)-1-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-(3-methylbut-2-enyl)-1-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97154272 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (3R)-3-(3-methylbut-2-enyl)-1-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)=CC[C@]1(C(=O)O)CCCN(C(=O)CN(C)Cc2ccncc2)C1 |
| InChI | InChI=1S/C20H29N3O3/c1-16(2)5-9-20(19(25)26)8-4-12-23(15-20)18(24)14-22(3)13-17-6-10-21-11-7-17/h5-7,10-11H,4,8-9,12-15H2,1-3H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | PCUXWBUUWBDPCH-HXUWFJFHSA-N |
| XLogP | 2.56 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|