C19H27NO3 — CID 97117701
(3S)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylic acid (PubChem CID 97117701) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3S)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97117701 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3S)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylic acid |
| SMILES | COCCC[C@@]1(C(=O)O)CCCN(C/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C19H27NO3/c1-23-15-7-12-19(18(21)22)11-6-14-20(16-19)13-5-10-17-8-3-2-4-9-17/h2-5,8-10H,6-7,11-16H2,1H3,(H,21,22)/b10-5+/t19-/m0/s1 |
| InChIKey | RYGASYMICJKKEK-GSXXRBPTSA-N |
| XLogP | 3.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|