C19H29NO2 — CID 97143432
[(3R)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidin-3-yl]methanol (PubChem CID 97143432) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is [(3R)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidin-3-yl]methanol.
| Compound Name | [(3R)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97143432 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | [(3R)-3-(3-methoxypropyl)-1-[(E)-3-phenylprop-2-enyl]piperidin-3-yl]methanol |
| SMILES | COCCC[C@]1(CO)CCCN(C/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C19H29NO2/c1-22-15-7-12-19(17-21)11-6-14-20(16-19)13-5-10-18-8-3-2-4-9-18/h2-5,8-10,21H,6-7,11-17H2,1H3/b10-5+/t19-/m1/s1 |
| InChIKey | PQXYDISDEZIBGV-CEQQRPIWSA-N |
| XLogP | 3.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|