C13H27NO4S — CID 72917410
[3-(3-methoxypropyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol (PubChem CID 72917410) has the molecular formula C13H27NO4S and a molecular weight of 293.43 g/mol. Its IUPAC name is [3-(3-methoxypropyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol.
| Compound Name | [3-(3-methoxypropyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 72917410 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | [3-(3-methoxypropyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol |
| SMILES | COCCCC1(CO)CCCN(CCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H27NO4S/c1-18-9-4-6-13(12-15)5-3-7-14(11-13)8-10-19(2,16)17/h15H,3-12H2,1-2H3 |
| InChIKey | CABHHGZEKSTLNC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|