C13H25NO3S — CID 72923462
[3-(cyclopropylmethyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol (PubChem CID 72923462) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is [3-(cyclopropylmethyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol.
| Compound Name | [3-(cyclopropylmethyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 72923462 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | [3-(cyclopropylmethyl)-1-(2-methylsulfonylethyl)piperidin-3-yl]methanol |
| SMILES | CS(=O)(=O)CCN1CCCC(CO)(CC2CC2)C1 |
| InChI | InChI=1S/C13H25NO3S/c1-18(16,17)8-7-14-6-2-5-13(10-14,11-15)9-12-3-4-12/h12,15H,2-11H2,1H3 |
| InChIKey | ZQWVGXFUPWATQQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |