C13H25N5O2 — CID 72867912
[3-(2-methoxyethyl)-1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]methanol (PubChem CID 72867912) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is [3-(2-methoxyethyl)-1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]methanol.
| Compound Name | [3-(2-methoxyethyl)-1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 72867912 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | [3-(2-methoxyethyl)-1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]methanol |
| SMILES | COCCC1(CO)CCCN(CCCn2cnnn2)C1 |
| InChI | InChI=1S/C13H25N5O2/c1-20-9-5-13(11-19)4-2-6-17(10-13)7-3-8-18-12-14-15-16-18/h12,19H,2-11H2,1H3 |
| InChIKey | WNRPVWDPBWQWMP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |