C18H27NO4 — CID 97131526
2-[4-[[(3S)-3-(hydroxymethyl)-3-(2-methoxyethyl)piperidin-1-yl]methyl]phenyl]acetic acid (PubChem CID 97131526) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[4-[[(3S)-3-(hydroxymethyl)-3-(2-methoxyethyl)piperidin-1-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[(3S)-3-(hydroxymethyl)-3-(2-methoxyethyl)piperidin-1-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 97131526 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-[4-[[(3S)-3-(hydroxymethyl)-3-(2-methoxyethyl)piperidin-1-yl]methyl]phenyl]acetic acid |
| SMILES | COCC[C@@]1(CO)CCCN(Cc2ccc(CC(=O)O)cc2)C1 |
| InChI | InChI=1S/C18H27NO4/c1-23-10-8-18(14-20)7-2-9-19(13-18)12-16-5-3-15(4-6-16)11-17(21)22/h3-6,20H,2,7-14H2,1H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | ORDYIGFARCJGKI-SFHVURJKSA-N |
| XLogP | 1.92 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |