C21H26ClNO2 — CID 25305426
[(3R)-1-[(4-chlorophenyl)methyl]-3-(2-phenoxyethyl)piperidin-3-yl]methanol (PubChem CID 25305426) has the molecular formula C21H26ClNO2 and a molecular weight of 359.90 g/mol. Its IUPAC name is [(3R)-1-[(4-chlorophenyl)methyl]-3-(2-phenoxyethyl)piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-[(4-chlorophenyl)methyl]-3-(2-phenoxyethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 25305426 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [(3R)-1-[(4-chlorophenyl)methyl]-3-(2-phenoxyethyl)piperidin-3-yl]methanol |
| SMILES | OC[C@@]1(CCOc2ccccc2)CCCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H26ClNO2/c22-19-9-7-18(8-10-19)15-23-13-4-11-21(16-23,17-24)12-14-25-20-5-2-1-3-6-20/h1-3,5-10,24H,4,11-17H2/t21-/m1/s1 |
| InChIKey | QRKYNFWSJPMMNX-OAQYLSRUSA-N |
| XLogP | 4.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |