C22H26ClNO3 — CID 26407540
2-(3-chlorophenyl)-1-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]ethanone (PubChem CID 26407540) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 26407540 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCC[C@@](CO)(CCOc2ccccc2)C1 |
| InChI | InChI=1S/C22H26ClNO3/c23-19-7-4-6-18(14-19)15-21(26)24-12-5-10-22(16-24,17-25)11-13-27-20-8-2-1-3-9-20/h1-4,6-9,14,25H,5,10-13,15-17H2/t22-/m1/s1 |
| InChIKey | YYTNRJYRPVNUKH-JOCHJYFZSA-N |
| XLogP | 3.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |