C17H24N2O4 — CID 128988937
3-hydroxy-1-[2-(3-propoxyphenyl)acetyl]piperidine-3-carboxamide (PubChem CID 128988937) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-hydroxy-1-[2-(3-propoxyphenyl)acetyl]piperidine-3-carboxamide.
| Compound Name | 3-hydroxy-1-[2-(3-propoxyphenyl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 128988937 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-hydroxy-1-[2-(3-propoxyphenyl)acetyl]piperidine-3-carboxamide |
| SMILES | CCCOc1cccc(CC(=O)N2CCCC(O)(C(N)=O)C2)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-2-9-23-14-6-3-5-13(10-14)11-15(20)19-8-4-7-17(22,12-19)16(18)21/h3,5-6,10,22H,2,4,7-9,11-12H2,1H3,(H2,18,21) |
| InChIKey | WMNBASZYNKFORN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |