C15H19FN2O4 — CID 128988914
1-[2-(5-fluoro-2-methoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide (PubChem CID 128988914) has the molecular formula C15H19FN2O4 and a molecular weight of 310.32 g/mol. Its IUPAC name is 1-[2-(5-fluoro-2-methoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide.
| Compound Name | 1-[2-(5-fluoro-2-methoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 128988914 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-[2-(5-fluoro-2-methoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide |
| SMILES | COc1ccc(F)cc1CC(=O)N1CCCC(O)(C(N)=O)C1 |
| InChI | InChI=1S/C15H19FN2O4/c1-22-12-4-3-11(16)7-10(12)8-13(19)18-6-2-5-15(21,9-18)14(17)20/h3-4,7,21H,2,5-6,8-9H2,1H3,(H2,17,20) |
| InChIKey | FPVDWGUYKITSSK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |