C16H22N2O4 — CID 128964748
1-[2-(4-ethoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide (PubChem CID 128964748) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[2-(4-ethoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide.
| Compound Name | 1-[2-(4-ethoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 128964748 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[2-(4-ethoxyphenyl)acetyl]-3-hydroxypiperidine-3-carboxamide |
| SMILES | CCOc1ccc(CC(=O)N2CCCC(O)(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C16H22N2O4/c1-2-22-13-6-4-12(5-7-13)10-14(19)18-9-3-8-16(21,11-18)15(17)20/h4-7,21H,2-3,8-11H2,1H3,(H2,17,20) |
| InChIKey | OEZLAFMHGVPCDS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |