C14H17ClN2O4 — CID 129485552
(3S)-1-(4-chloro-2-methoxybenzoyl)-3-hydroxypiperidine-3-carboxamide (PubChem CID 129485552) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is (3S)-1-(4-chloro-2-methoxybenzoyl)-3-hydroxypiperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chloro-2-methoxybenzoyl)-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 129485552 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (3S)-1-(4-chloro-2-methoxybenzoyl)-3-hydroxypiperidine-3-carboxamide |
| SMILES | COc1cc(Cl)ccc1C(=O)N1CCC[C@@](O)(C(N)=O)C1 |
| InChI | InChI=1S/C14H17ClN2O4/c1-21-11-7-9(15)3-4-10(11)12(18)17-6-2-5-14(20,8-17)13(16)19/h3-4,7,20H,2,5-6,8H2,1H3,(H2,16,19)/t14-/m0/s1 |
| InChIKey | HQNOXCKWJLKGMM-AWEZNQCLSA-N |
| XLogP | 0.80 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |