C14H17ClN2O3 — CID 128964411
1-(4-chloro-3-methylbenzoyl)-3-hydroxypiperidine-3-carboxamide (PubChem CID 128964411) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 1-(4-chloro-3-methylbenzoyl)-3-hydroxypiperidine-3-carboxamide.
| Compound Name | 1-(4-chloro-3-methylbenzoyl)-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 128964411 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-(4-chloro-3-methylbenzoyl)-3-hydroxypiperidine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCCC(O)(C(N)=O)C2)ccc1Cl |
| InChI | InChI=1S/C14H17ClN2O3/c1-9-7-10(3-4-11(9)15)12(18)17-6-2-5-14(20,8-17)13(16)19/h3-4,7,20H,2,5-6,8H2,1H3,(H2,16,19) |
| InChIKey | GISUQGMTGOILNR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |