C14H15ClF3NO2 — CID 86781380
(4-chloro-3-methylphenyl)-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 86781380) has the molecular formula C14H15ClF3NO2 and a molecular weight of 321.73 g/mol. Its IUPAC name is (4-chloro-3-methylphenyl)-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (4-chloro-3-methylphenyl)-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86781380 |
| Molecular Formula | C14H15ClF3NO2 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (4-chloro-3-methylphenyl)-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC(O)(C(F)(F)F)CC2)ccc1Cl |
| InChI | InChI=1S/C14H15ClF3NO2/c1-9-8-10(2-3-11(9)15)12(20)19-6-4-13(21,5-7-19)14(16,17)18/h2-3,8,21H,4-7H2,1H3 |
| InChIKey | POZJOVIAZIZQNV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |