C19H20N2O4 — CID 129485563
(3R)-3-hydroxy-1-(2-phenoxybenzoyl)piperidine-3-carboxamide (PubChem CID 129485563) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-(2-phenoxybenzoyl)piperidine-3-carboxamide.
| Compound Name | (3R)-3-hydroxy-1-(2-phenoxybenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 129485563 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3R)-3-hydroxy-1-(2-phenoxybenzoyl)piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@]1(O)CCCN(C(=O)c2ccccc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C19H20N2O4/c20-18(23)19(24)11-6-12-21(13-19)17(22)15-9-4-5-10-16(15)25-14-7-2-1-3-8-14/h1-5,7-10,24H,6,11-13H2,(H2,20,23)/t19-/m1/s1 |
| InChIKey | HRNHUQZCIOKOIL-LJQANCHMSA-N |
| XLogP | 1.93 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |