C19H27NO5 — CID 26411573
methyl 4-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]-4-oxobutanoate (PubChem CID 26411573) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 4-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 26411573 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | methyl 4-[(3R)-3-(hydroxymethyl)-3-(2-phenoxyethyl)piperidin-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCC[C@@](CO)(CCOc2ccccc2)C1 |
| InChI | InChI=1S/C19H27NO5/c1-24-18(23)9-8-17(22)20-12-5-10-19(14-20,15-21)11-13-25-16-6-3-2-4-7-16/h2-4,6-7,21H,5,8-15H2,1H3/t19-/m1/s1 |
| InChIKey | TZXAQIZWVAWCNC-LJQANCHMSA-N |
| XLogP | 2.01 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |