C23H26ClNO3 — CID 25369962
[(3R)-3-[(3-chlorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone (PubChem CID 25369962) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is [(3R)-3-[(3-chlorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone.
| Compound Name | [(3R)-3-[(3-chlorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 25369962 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [(3R)-3-[(3-chlorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1cccc(C(=O)N2CCC[C@@](CO)(Cc3cccc(Cl)c3)C2)c1 |
| InChI | InChI=1S/C23H26ClNO3/c1-2-12-28-21-9-4-7-19(14-21)22(27)25-11-5-10-23(16-25,17-26)15-18-6-3-8-20(24)13-18/h2-4,6-9,13-14,26H,1,5,10-12,15-17H2/t23-/m1/s1 |
| InChIKey | GZEVVLVGKLCARX-HSZRJFAPSA-N |
| XLogP | 4.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|