C16H19ClFNO2 — CID 72905035
(3-chloro-4-fluorophenyl)-[3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methanone (PubChem CID 72905035) has the molecular formula C16H19ClFNO2 and a molecular weight of 311.78 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 72905035 |
| Molecular Formula | C16H19ClFNO2 |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methanone |
| SMILES | C=CCC1(CO)CCCN(C(=O)c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H19ClFNO2/c1-2-6-16(11-20)7-3-8-19(10-16)15(21)12-4-5-14(18)13(17)9-12/h2,4-5,9,20H,1,3,6-8,10-11H2 |
| InChIKey | FMUMUJXPZLQFPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|