C15H19ClFNO3S — CID 97140915
[(3S)-1-(2-chloro-4-fluorophenyl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 97140915) has the molecular formula C15H19ClFNO3S and a molecular weight of 347.84 g/mol. Its IUPAC name is [(3S)-1-(2-chloro-4-fluorophenyl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(2-chloro-4-fluorophenyl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97140915 |
| Molecular Formula | C15H19ClFNO3S |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [(3S)-1-(2-chloro-4-fluorophenyl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CC[C@@]1(CO)CCCN(S(=O)(=O)c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C15H19ClFNO3S/c1-2-6-15(11-19)7-3-8-18(10-15)22(20,21)14-5-4-12(17)9-13(14)16/h2,4-5,9,19H,1,3,6-8,10-11H2/t15-/m1/s1 |
| InChIKey | RIJKALLYHJSVLB-OAHLLOKOSA-N |
| XLogP | 2.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|