C19H21F2NO3S — CID 45210574
[3-benzyl-1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methanol (PubChem CID 45210574) has the molecular formula C19H21F2NO3S and a molecular weight of 381.44 g/mol. Its IUPAC name is [3-benzyl-1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methanol.
| Compound Name | [3-benzyl-1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 45210574 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [3-benzyl-1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methanol |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCCC(CO)(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H21F2NO3S/c20-16-7-8-18(17(21)11-16)26(24,25)22-10-4-9-19(13-22,14-23)12-15-5-2-1-3-6-15/h1-3,5-8,11,23H,4,9-10,12-14H2 |
| InChIKey | YQIZXDHTFIZYLH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |