C22H24FN3O3S — CID 139001905
[1-(1-benzylpyrazol-4-yl)sulfonyl-3-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]methanol (PubChem CID 139001905) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is [1-(1-benzylpyrazol-4-yl)sulfonyl-3-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-(1-benzylpyrazol-4-yl)sulfonyl-3-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 139001905 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [1-(1-benzylpyrazol-4-yl)sulfonyl-3-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(c1cnn(Cc2ccccc2)c1)N1CCC(CO)(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H24FN3O3S/c23-20-8-6-18(7-9-20)12-22(17-27)10-11-26(16-22)30(28,29)21-13-24-25(15-21)14-19-4-2-1-3-5-19/h1-9,13,15,27H,10-12,14,16-17H2 |
| InChIKey | HKVAKBZORAQPFN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |