C14H23N3O3S — CID 97137341
[(3R)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 97137341) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is [(3R)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol.
| Compound Name | [(3R)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97137341 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(3R)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-3-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CC[C@]1(CO)CCCN(S(=O)(=O)c2cn(C)nc2C)C1 |
| InChI | InChI=1S/C14H23N3O3S/c1-4-6-14(11-18)7-5-8-17(10-14)21(19,20)13-9-16(3)15-12(13)2/h4,9,18H,1,5-8,10-11H2,2-3H3/t14-/m0/s1 |
| InChIKey | TYUWMIHJAYVJKJ-AWEZNQCLSA-N |
| XLogP | 1.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|