C17H29N3O3S — CID 97128182
[(3R)-1-(1-ethyl-5-methylpyrazol-4-yl)sulfonyl-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol (PubChem CID 97128182) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is [(3R)-1-(1-ethyl-5-methylpyrazol-4-yl)sulfonyl-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-(1-ethyl-5-methylpyrazol-4-yl)sulfonyl-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97128182 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(3R)-1-(1-ethyl-5-methylpyrazol-4-yl)sulfonyl-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol |
| SMILES | CCn1ncc(S(=O)(=O)N2CCC[C@@](CO)(CC=C(C)C)C2)c1C |
| InChI | InChI=1S/C17H29N3O3S/c1-5-20-15(4)16(11-18-20)24(22,23)19-10-6-8-17(12-19,13-21)9-7-14(2)3/h7,11,21H,5-6,8-10,12-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | WKFYZJOYGNSLKJ-QGZVFWFLSA-N |
| XLogP | 2.33 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|