C10H8ClFN2O4S — CID 66083632
4-(2-chloro-4-fluorophenyl)sulfonylpiperazine-2,6-dione (PubChem CID 66083632) has the molecular formula C10H8ClFN2O4S and a molecular weight of 306.70 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)sulfonylpiperazine-2,6-dione.
| Compound Name | 4-(2-chloro-4-fluorophenyl)sulfonylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66083632 |
| Molecular Formula | C10H8ClFN2O4S |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)sulfonylpiperazine-2,6-dione |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(F)cc2Cl)CC(=O)N1 |
| InChI | InChI=1S/C10H8ClFN2O4S/c11-7-3-6(12)1-2-8(7)19(17,18)14-4-9(15)13-10(16)5-14/h1-3H,4-5H2,(H,13,15,16) |
| InChIKey | HIOYFYULYOXHHG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|