C19H31NO2 — CID 97119619
[(3S)-1-[(2,5-dimethylphenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol (PubChem CID 97119619) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is [(3S)-1-[(2,5-dimethylphenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-[(2,5-dimethylphenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97119619 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | [(3S)-1-[(2,5-dimethylphenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol |
| SMILES | COCCC[C@@]1(CO)CCCN(Cc2cc(C)ccc2C)C1 |
| InChI | InChI=1S/C19H31NO2/c1-16-6-7-17(2)18(12-16)13-20-10-4-8-19(14-20,15-21)9-5-11-22-3/h6-7,12,21H,4-5,8-11,13-15H2,1-3H3/t19-/m0/s1 |
| InChIKey | ZFQAZGSDSULWJB-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|