C17H25ClFNO2 — CID 97115465
[(3S)-1-[(2-chloro-4-fluorophenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol (PubChem CID 97115465) has the molecular formula C17H25ClFNO2 and a molecular weight of 329.84 g/mol. Its IUPAC name is [(3S)-1-[(2-chloro-4-fluorophenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-[(2-chloro-4-fluorophenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97115465 |
| Molecular Formula | C17H25ClFNO2 |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(3S)-1-[(2-chloro-4-fluorophenyl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol |
| SMILES | COCCC[C@@]1(CO)CCCN(Cc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C17H25ClFNO2/c1-22-9-3-7-17(13-21)6-2-8-20(12-17)11-14-4-5-15(19)10-16(14)18/h4-5,10,21H,2-3,6-9,11-13H2,1H3/t17-/m0/s1 |
| InChIKey | XCZFIXZQBYPJIS-KRWDZBQOSA-N |
| XLogP | 3.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|