C16H28N2O2S — CID 72940800
[1-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol (PubChem CID 72940800) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is [1-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol.
| Compound Name | [1-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 72940800 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [1-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-3-(3-methoxypropyl)piperidin-3-yl]methanol |
| SMILES | COCCCC1(CO)CCCN(Cc2nc(C)sc2C)C1 |
| InChI | InChI=1S/C16H28N2O2S/c1-13-15(17-14(2)21-13)10-18-8-4-6-16(11-18,12-19)7-5-9-20-3/h19H,4-12H2,1-3H3 |
| InChIKey | PSOQYUQQZAYNPR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|