C18H25NO — CID 165422452
(4R,5S)-7-[(E)-3-phenylprop-2-enyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 165422452) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (4R,5S)-7-[(E)-3-phenylprop-2-enyl]-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5S)-7-[(E)-3-phenylprop-2-enyl]-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 165422452 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (4R,5S)-7-[(E)-3-phenylprop-2-enyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | O[C@@H]1CCC[C@@]12CCCN(C/C=C/c1ccccc1)C2 |
| InChI | InChI=1S/C18H25NO/c20-17-10-4-11-18(17)12-6-14-19(15-18)13-5-9-16-7-2-1-3-8-16/h1-3,5,7-9,17,20H,4,6,10-15H2/b9-5+/t17-,18+/m1/s1 |
| InChIKey | DLQGNQAJOKEGQV-LUUOPXGJSA-N |
| XLogP | 3.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |