C16H22ClNO — CID 135097855
(4R,5S)-7-[(4-chlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 135097855) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is (4R,5S)-7-[(4-chlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5S)-7-[(4-chlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 135097855 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (4R,5S)-7-[(4-chlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | O[C@@H]1CCC[C@@]12CCCN(Cc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C16H22ClNO/c17-14-6-4-13(5-7-14)11-18-10-2-9-16(12-18)8-1-3-15(16)19/h4-7,15,19H,1-3,8-12H2/t15-,16+/m1/s1 |
| InChIKey | KSWGLFPBHJJNPY-CVEARBPZSA-N |
| XLogP | 3.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |