C16H21Cl2NO — CID 135091462
(4R,5R)-7-[(2,6-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 135091462) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is (4R,5R)-7-[(2,6-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5R)-7-[(2,6-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 135091462 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (4R,5R)-7-[(2,6-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | O[C@@H]1CCC[C@]12CCCN(Cc1c(Cl)cccc1Cl)C2 |
| InChI | InChI=1S/C16H21Cl2NO/c17-13-4-1-5-14(18)12(13)10-19-9-3-8-16(11-19)7-2-6-15(16)20/h1,4-5,15,20H,2-3,6-11H2/t15-,16-/m1/s1 |
| InChIKey | HPVUBOZMZLYZPQ-HZPDHXFCSA-N |
| XLogP | 4.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |