C25H40N2O2 — CID 165424125
(4R,5S)-7-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 165424125) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (4R,5S)-7-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5S)-7-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 165424125 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | (4R,5S)-7-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | O[C@@H]1CCC[C@@]12CCCN(Cc1cccc(OCCCCN3CCCCC3)c1)C2 |
| InChI | InChI=1S/C25H40N2O2/c28-24-11-7-12-25(24)13-8-17-27(21-25)20-22-9-6-10-23(19-22)29-18-5-4-16-26-14-2-1-3-15-26/h6,9-10,19,24,28H,1-5,7-8,11-18,20-21H2/t24-,25+/m1/s1 |
| InChIKey | PHJWYFXLMYQAOQ-RPBOFIJWSA-N |
| XLogP | 4.46 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|