C25H38N2O3 — CID 155495192
[(1S,5S,6R,7R)-3-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol (PubChem CID 155495192) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is [(1S,5S,6R,7R)-3-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol.
| Compound Name | [(1S,5S,6R,7R)-3-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
|---|---|
| PubChem CID | 155495192 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | [(1S,5S,6R,7R)-3-[[3-(4-piperidin-1-ylbutoxy)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
| SMILES | OC[C@H]1[C@H]2CN(Cc3cccc(OCCCCN4CCCCC4)c3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C25H38N2O3/c28-18-22-23-17-27(19-25(23)10-9-24(22)30-25)16-20-7-6-8-21(15-20)29-14-5-4-13-26-11-2-1-3-12-26/h6-8,15,22-24,28H,1-5,9-14,16-19H2/t22-,23+,24+,25+/m0/s1 |
| InChIKey | HUNRLMQRUWYGEA-ZYQDXHPFSA-N |
| XLogP | 3.30 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|