C19H29NO — CID 135120621
(4R,5R)-7-(4-phenylbutyl)-7-azaspiro[4.5]decan-4-ol (PubChem CID 135120621) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (4R,5R)-7-(4-phenylbutyl)-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5R)-7-(4-phenylbutyl)-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 135120621 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (4R,5R)-7-(4-phenylbutyl)-7-azaspiro[4.5]decan-4-ol |
| SMILES | O[C@@H]1CCC[C@]12CCCN(CCCCc1ccccc1)C2 |
| InChI | InChI=1S/C19H29NO/c21-18-11-6-12-19(18)13-7-15-20(16-19)14-5-4-10-17-8-2-1-3-9-17/h1-3,8-9,18,21H,4-7,10-16H2/t18-,19-/m1/s1 |
| InChIKey | JCIBSGOOXMEZBA-RTBURBONSA-N |
| XLogP | 3.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|