C18H27NO3 — CID 154915709
formic acid;(4R,5R)-7-(2-phenylethyl)-7-azaspiro[4.5]decan-4-ol (PubChem CID 154915709) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is formic acid;(4R,5R)-7-(2-phenylethyl)-7-azaspiro[4.5]decan-4-ol.
| Compound Name | formic acid;(4R,5R)-7-(2-phenylethyl)-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 154915709 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | formic acid;(4R,5R)-7-(2-phenylethyl)-7-azaspiro[4.5]decan-4-ol |
| SMILES | O=CO.O[C@@H]1CCC[C@]12CCCN(CCc1ccccc1)C2 |
| InChI | InChI=1S/C17H25NO.CH2O2/c19-16-8-4-10-17(16)11-5-12-18(14-17)13-9-15-6-2-1-3-7-15;2-1-3/h1-3,6-7,16,19H,4-5,8-14H2;1H,(H,2,3)/t16-,17-;/m1./s1 |
| InChIKey | BUVZWBQVXRWEEL-GBNZRNLASA-N |
| XLogP | 2.56 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|