C16H23NO2 — CID 72916080
(1S,3R)-7-(2-phenylethyl)-7-azaspiro[3.5]nonane-1,3-diol (PubChem CID 72916080) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (1S,3R)-7-(2-phenylethyl)-7-azaspiro[3.5]nonane-1,3-diol.
| Compound Name | (1S,3R)-7-(2-phenylethyl)-7-azaspiro[3.5]nonane-1,3-diol |
|---|---|
| PubChem CID | 72916080 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (1S,3R)-7-(2-phenylethyl)-7-azaspiro[3.5]nonane-1,3-diol |
| SMILES | O[C@@H]1C[C@H](O)C12CCN(CCc1ccccc1)CC2 |
| InChI | InChI=1S/C16H23NO2/c18-14-12-15(19)16(14)7-10-17(11-8-16)9-6-13-4-2-1-3-5-13/h1-5,14-15,18-19H,6-12H2/t14-,15+ |
| InChIKey | FIQVKYRFCQBIPI-GASCZTMLSA-N |
| XLogP | 1.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |