C23H31N3O3 — CID 171692325
3-anilino-N,N-dimethyl-1-(2-phenylethyl)piperidine-3-carboxamide;formic acid (PubChem CID 171692325) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-anilino-N,N-dimethyl-1-(2-phenylethyl)piperidine-3-carboxamide;formic acid.
| Compound Name | 3-anilino-N,N-dimethyl-1-(2-phenylethyl)piperidine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 171692325 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3-anilino-N,N-dimethyl-1-(2-phenylethyl)piperidine-3-carboxamide;formic acid |
| SMILES | CN(C)C(=O)C1(Nc2ccccc2)CCCN(CCc2ccccc2)C1.O=CO |
| InChI | InChI=1S/C22H29N3O.CH2O2/c1-24(2)21(26)22(23-20-12-7-4-8-13-20)15-9-16-25(18-22)17-14-19-10-5-3-6-11-19;2-1-3/h3-8,10-13,23H,9,14-18H2,1-2H3;1H,(H,2,3) |
| InChIKey | JNDJATWPXHNTAL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|