C18H26N2O2 — CID 122556302
1-[[1-(2-phenylethyl)piperidin-4-yl]amino]cyclobutane-1-carboxylic acid (PubChem CID 122556302) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[[1-(2-phenylethyl)piperidin-4-yl]amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[1-(2-phenylethyl)piperidin-4-yl]amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 122556302 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[[1-(2-phenylethyl)piperidin-4-yl]amino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(NC2CCN(CCc3ccccc3)CC2)CCC1 |
| InChI | InChI=1S/C18H26N2O2/c21-17(22)18(10-4-11-18)19-16-8-13-20(14-9-16)12-7-15-5-2-1-3-6-15/h1-3,5-6,16,19H,4,7-14H2,(H,21,22) |
| InChIKey | KPJZROCCFKZCKY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |