C20H25N2NaO2 — CID 173365914
sodium;4-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid;hydride (PubChem CID 173365914) has the molecular formula C20H25N2NaO2 and a molecular weight of 348.42 g/mol. Its IUPAC name is sodium;4-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid;hydride.
| Compound Name | sodium;4-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid;hydride |
|---|---|
| PubChem CID | 173365914 |
| Molecular Formula | C20H25N2NaO2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | sodium;4-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid;hydride |
| SMILES | O=C(O)C1(Nc2ccccc2)CCN(CCc2ccccc2)CC1.[H-].[Na+] |
| InChI | InChI=1S/C20H24N2O2.Na.H/c23-19(24)20(21-18-9-5-2-6-10-18)12-15-22(16-13-20)14-11-17-7-3-1-4-8-17;;/h1-10,21H,11-16H2,(H,23,24);;/q;+1;-1 |
| InChIKey | NBPLEWXDHORJFP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |