C19H23N3O — CID 45040221
1-benzyl-4-((1,2,3,4,5,6-13C6)cyclohexatrienylamino)piperidine-4-carboxamide (PubChem CID 45040221) has the molecular formula C19H23N3O and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-benzyl-4-((1,2,3,4,5,6-13C6)cyclohexatrienylamino)piperidine-4-carboxamide.
| Compound Name | 1-benzyl-4-((1,2,3,4,5,6-13C6)cyclohexatrienylamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45040221 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1-benzyl-4-((1,2,3,4,5,6-13C6)cyclohexatrienylamino)piperidine-4-carboxamide |
| SMILES | NC(=O)C1(N[13c]2[13cH][13cH][13cH][13cH][13cH]2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N3O/c20-18(23)19(21-17-9-5-2-6-10-17)11-13-22(14-12-19)15-16-7-3-1-4-8-16/h1-10,21H,11-15H2,(H2,20,23)/i2+1,5+1,6+1,9+1,10+1,17+1 |
| InChIKey | PUFOFCNHIWPPNN-IPTBCTDGSA-N |
| XLogP | 2.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |