C14H18F3N3O — CID 60999133
1-benzyl-3-(2,2,2-trifluoroethylamino)pyrrolidine-3-carboxamide (PubChem CID 60999133) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 1-benzyl-3-(2,2,2-trifluoroethylamino)pyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-3-(2,2,2-trifluoroethylamino)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 60999133 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-benzyl-3-(2,2,2-trifluoroethylamino)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1(NCC(F)(F)F)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H18F3N3O/c15-14(16,17)9-19-13(12(18)21)6-7-20(10-13)8-11-4-2-1-3-5-11/h1-5,19H,6-10H2,(H2,18,21) |
| InChIKey | HHIGCBWGMDKRLN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |