C20H24N2O2 — CID 171395102
methyl 1-benzyl-4-(2,3,4,5,6-pentadeuterioanilino)piperidine-4-carboxylate (PubChem CID 171395102) has the molecular formula C20H24N2O2 and a molecular weight of 329.45 g/mol. Its IUPAC name is methyl 1-benzyl-4-(2,3,4,5,6-pentadeuterioanilino)piperidine-4-carboxylate.
| Compound Name | methyl 1-benzyl-4-(2,3,4,5,6-pentadeuterioanilino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 171395102 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | methyl 1-benzyl-4-(2,3,4,5,6-pentadeuterioanilino)piperidine-4-carboxylate |
| SMILES | [2H]c1c([2H])c([2H])c(NC2(C(=O)OC)CCN(Cc3ccccc3)CC2)c([2H])c1[2H] |
| InChI | InChI=1S/C20H24N2O2/c1-24-19(23)20(21-18-10-6-3-7-11-18)12-14-22(15-13-20)16-17-8-4-2-5-9-17/h2-11,21H,12-16H2,1H3/i3D,6D,7D,10D,11D |
| InChIKey | NPNNCHCGYDKUTA-LKOJFEAXSA-N |
| XLogP | 3.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |